About (3-butylbenzoyl) 3-butylbenzoate
(3-butylbenzoyl) 3-butylbenzoate (PubChem CID 139993178) has the molecular formula C22H26O3
and a molecular weight of 338.45 g/mol. Its IUPAC name is (3-butylbenzoyl) 3-butylbenzoate.
Molecular Properties
| Compound Name | (3-butylbenzoyl) 3-butylbenzoate |
| PubChem CID | 139993178 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (3-butylbenzoyl) 3-butylbenzoate |
| SMILES | CCCCc1cccc(C(=O)OC(=O)c2cccc(CCCC)c2)c1 |
| InChI | InChI=1S/C22H26O3/c1-3-5-9-17-11-7-13-19(15-17)21(23)25-22(24)20-14-8-12-18(16-20)10-6-4-2/h7-8,11-16H,3-6,9-10H2,1-2H3 |
| InChIKey | SFWCKWBUPAVLTI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (3-butylbenzoyl) 3-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-butylbenzoyl) 3-butylbenzoate?
The IUPAC name of (3-butylbenzoyl) 3-butylbenzoate (CID 139993178) is (3-butylbenzoyl) 3-butylbenzoate.
What is the SMILES notation for (3-butylbenzoyl) 3-butylbenzoate?
The canonical SMILES for (3-butylbenzoyl) 3-butylbenzoate is CCCCc1cccc(C(=O)OC(=O)c2cccc(CCCC)c2)c1.
What is the InChIKey of (3-butylbenzoyl) 3-butylbenzoate?
The InChIKey is SFWCKWBUPAVLTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26O3/c1-3-5-9-17-11-7-13-19(15-17)21(23)25-22(24)20-14-8-12-18(16-20)10-6-4-2/h7-8,11-16H,3-6,9-10H2,1-2H3.
What are the key properties of (3-butylbenzoyl) 3-butylbenzoate?
(3-butylbenzoyl) 3-butylbenzoate has a molecular weight of 338.45 g/mol, XLogP of 5.37, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-butylbenzoyl) 3-butylbenzoate is sourced from PubChem (CID 139993178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).