About lithium 3-butylbenzoate
lithium 3-butylbenzoate (PubChem CID 101299949) has the molecular formula C11H13LiO2
and a molecular weight of 184.16 g/mol. Its IUPAC name is lithium 3-butylbenzoate.
Molecular Properties
| Compound Name | lithium 3-butylbenzoate |
| PubChem CID | 101299949 |
| Molecular Formula | C11H13LiO2 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | lithium 3-butylbenzoate |
| SMILES | CCCCc1cccc(C(=O)[O-])c1.[Li+] |
| InChI | InChI=1S/C11H14O2.Li/c1-2-3-5-9-6-4-7-10(8-9)11(12)13;/h4,6-8H,2-3,5H2,1H3,(H,12,13);/q;+1/p-1 |
| InChIKey | CQMDTTHZBLUWLF-UHFFFAOYSA-M |
| XLogP | -1.60 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze lithium 3-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 3-butylbenzoate?
The IUPAC name of lithium 3-butylbenzoate (CID 101299949) is lithium 3-butylbenzoate.
What is the SMILES notation for lithium 3-butylbenzoate?
The canonical SMILES for lithium 3-butylbenzoate is CCCCc1cccc(C(=O)[O-])c1.[Li+].
What is the InChIKey of lithium 3-butylbenzoate?
The InChIKey is CQMDTTHZBLUWLF-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H14O2.Li/c1-2-3-5-9-6-4-7-10(8-9)11(12)13;/h4,6-8H,2-3,5H2,1H3,(H,12,13);/q;+1/p-1.
What are the key properties of lithium 3-butylbenzoate?
lithium 3-butylbenzoate has a molecular weight of 184.16 g/mol, XLogP of -1.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 3-butylbenzoate is sourced from PubChem (CID 101299949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).