About methanol;2-oxo-2-(3-pentylphenyl)acetic acid
methanol;2-oxo-2-(3-pentylphenyl)acetic acid (PubChem CID 144699085) has the molecular formula C14H20O4
and a molecular weight of 252.31 g/mol. Its IUPAC name is methanol;2-oxo-2-(3-pentylphenyl)acetic acid.
Molecular Properties
| Compound Name | methanol;2-oxo-2-(3-pentylphenyl)acetic acid |
| PubChem CID | 144699085 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | methanol;2-oxo-2-(3-pentylphenyl)acetic acid |
| SMILES | CCCCCc1cccc(C(=O)C(=O)O)c1.CO |
| InChI | InChI=1S/C13H16O3.CH4O/c1-2-3-4-6-10-7-5-8-11(9-10)12(14)13(15)16;1-2/h5,7-9H,2-4,6H2,1H3,(H,15,16);2H,1H3 |
| InChIKey | BUVKEDFPGGOPNG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methanol;2-oxo-2-(3-pentylphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-oxo-2-(3-pentylphenyl)acetic acid?
The IUPAC name of methanol;2-oxo-2-(3-pentylphenyl)acetic acid (CID 144699085) is methanol;2-oxo-2-(3-pentylphenyl)acetic acid.
What is the SMILES notation for methanol;2-oxo-2-(3-pentylphenyl)acetic acid?
The canonical SMILES for methanol;2-oxo-2-(3-pentylphenyl)acetic acid is CCCCCc1cccc(C(=O)C(=O)O)c1.CO.
What is the InChIKey of methanol;2-oxo-2-(3-pentylphenyl)acetic acid?
The InChIKey is BUVKEDFPGGOPNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3.CH4O/c1-2-3-4-6-10-7-5-8-11(9-10)12(14)13(15)16;1-2/h5,7-9H,2-4,6H2,1H3,(H,15,16);2H,1H3.
What are the key properties of methanol;2-oxo-2-(3-pentylphenyl)acetic acid?
methanol;2-oxo-2-(3-pentylphenyl)acetic acid has a molecular weight of 252.31 g/mol, XLogP of 2.30, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-oxo-2-(3-pentylphenyl)acetic acid is sourced from PubChem (CID 144699085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).