C27H36O2 — CID 130220574
1-(3-butylphenyl)-3-(3,5-dibutylphenyl)propane-1,3-dione (PubChem CID 130220574) has the molecular formula C27H36O2 and a molecular weight of 392.58 g/mol. Its IUPAC name is 1-(3-butylphenyl)-3-(3,5-dibutylphenyl)propane-1,3-dione.
| Compound Name | 1-(3-butylphenyl)-3-(3,5-dibutylphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 130220574 |
| Molecular Formula | C27H36O2 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 1-(3-butylphenyl)-3-(3,5-dibutylphenyl)propane-1,3-dione |
| SMILES | CCCCc1cccc(C(=O)CC(=O)c2cc(CCCC)cc(CCCC)c2)c1 |
| InChI | InChI=1S/C27H36O2/c1-4-7-11-21-14-10-15-24(17-21)26(28)20-27(29)25-18-22(12-8-5-2)16-23(19-25)13-9-6-3/h10,14-19H,4-9,11-13,20H2,1-3H3 |
| InChIKey | ULTKPCMJOLHBOQ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|