About methyl 3-propylbenzoate
methyl 3-propylbenzoate (PubChem CID 12861009) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is methyl 3-propylbenzoate.
Molecular Properties
| Compound Name | methyl 3-propylbenzoate |
| PubChem CID | 12861009 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | methyl 3-propylbenzoate |
| SMILES | CCCc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C11H14O2/c1-3-5-9-6-4-7-10(8-9)11(12)13-2/h4,6-8H,3,5H2,1-2H3 |
| InChIKey | QIIZYRMLEIRAES-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 3-propylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-propylbenzoate?
The IUPAC name of methyl 3-propylbenzoate (CID 12861009) is methyl 3-propylbenzoate.
What is the SMILES notation for methyl 3-propylbenzoate?
The canonical SMILES for methyl 3-propylbenzoate is CCCc1cccc(C(=O)OC)c1.
What is the InChIKey of methyl 3-propylbenzoate?
The InChIKey is QIIZYRMLEIRAES-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-3-5-9-6-4-7-10(8-9)11(12)13-2/h4,6-8H,3,5H2,1-2H3.
What are the key properties of methyl 3-propylbenzoate?
methyl 3-propylbenzoate has a molecular weight of 178.23 g/mol, XLogP of 2.43, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-propylbenzoate is sourced from PubChem (CID 12861009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).