About methyl 3-(5-oxopentyl)benzoate
methyl 3-(5-oxopentyl)benzoate (PubChem CID 13244315) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is methyl 3-(5-oxopentyl)benzoate.
Molecular Properties
| Compound Name | methyl 3-(5-oxopentyl)benzoate |
| PubChem CID | 13244315 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | methyl 3-(5-oxopentyl)benzoate |
| SMILES | COC(=O)c1cccc(CCCCC=O)c1 |
| InChI | InChI=1S/C13H16O3/c1-16-13(15)12-8-5-7-11(10-12)6-3-2-4-9-14/h5,7-10H,2-4,6H2,1H3 |
| InChIKey | FDVGPTKHUVMSEA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(5-oxopentyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(5-oxopentyl)benzoate?
The IUPAC name of methyl 3-(5-oxopentyl)benzoate (CID 13244315) is methyl 3-(5-oxopentyl)benzoate.
What is the SMILES notation for methyl 3-(5-oxopentyl)benzoate?
The canonical SMILES for methyl 3-(5-oxopentyl)benzoate is COC(=O)c1cccc(CCCCC=O)c1.
What is the InChIKey of methyl 3-(5-oxopentyl)benzoate?
The InChIKey is FDVGPTKHUVMSEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-16-13(15)12-8-5-7-11(10-12)6-3-2-4-9-14/h5,7-10H,2-4,6H2,1H3.
What are the key properties of methyl 3-(5-oxopentyl)benzoate?
methyl 3-(5-oxopentyl)benzoate has a molecular weight of 220.27 g/mol, XLogP of 2.38, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(5-oxopentyl)benzoate is sourced from PubChem (CID 13244315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).