About 3-(12-oxododecyl)benzoic acid
3-(12-oxododecyl)benzoic acid (PubChem CID 87632066) has the molecular formula C19H28O3
and a molecular weight of 304.43 g/mol. Its IUPAC name is 3-(12-oxododecyl)benzoic acid.
Molecular Properties
| Compound Name | 3-(12-oxododecyl)benzoic acid |
| PubChem CID | 87632066 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 3-(12-oxododecyl)benzoic acid |
| SMILES | O=CCCCCCCCCCCCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C19H28O3/c20-15-10-8-6-4-2-1-3-5-7-9-12-17-13-11-14-18(16-17)19(21)22/h11,13-16H,1-10,12H2,(H,21,22) |
| InChIKey | JHVYZTOKUQDUIX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(12-oxododecyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(12-oxododecyl)benzoic acid?
The IUPAC name of 3-(12-oxododecyl)benzoic acid (CID 87632066) is 3-(12-oxododecyl)benzoic acid.
What is the SMILES notation for 3-(12-oxododecyl)benzoic acid?
The canonical SMILES for 3-(12-oxododecyl)benzoic acid is O=CCCCCCCCCCCCc1cccc(C(=O)O)c1.
What is the InChIKey of 3-(12-oxododecyl)benzoic acid?
The InChIKey is JHVYZTOKUQDUIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O3/c20-15-10-8-6-4-2-1-3-5-7-9-12-17-13-11-14-18(16-17)19(21)22/h11,13-16H,1-10,12H2,(H,21,22).
What are the key properties of 3-(12-oxododecyl)benzoic acid?
3-(12-oxododecyl)benzoic acid has a molecular weight of 304.43 g/mol, XLogP of 5.03, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(12-oxododecyl)benzoic acid is sourced from PubChem (CID 87632066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).