About methane;3-(3-oxopropyl)benzamide
methane;3-(3-oxopropyl)benzamide (PubChem CID 178062718) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is methane;3-(3-oxopropyl)benzamide.
Molecular Properties
| Compound Name | methane;3-(3-oxopropyl)benzamide |
| PubChem CID | 178062718 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | methane;3-(3-oxopropyl)benzamide |
| SMILES | C.NC(=O)c1cccc(CCC=O)c1 |
| InChI | InChI=1S/C10H11NO2.CH4/c11-10(13)9-5-1-3-8(7-9)4-2-6-12;/h1,3,5-7H,2,4H2,(H2,11,13);1H4 |
| InChIKey | PXHLHJFUQDVOAC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methane;3-(3-oxopropyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-(3-oxopropyl)benzamide?
The IUPAC name of methane;3-(3-oxopropyl)benzamide (CID 178062718) is methane;3-(3-oxopropyl)benzamide.
What is the SMILES notation for methane;3-(3-oxopropyl)benzamide?
The canonical SMILES for methane;3-(3-oxopropyl)benzamide is C.NC(=O)c1cccc(CCC=O)c1.
What is the InChIKey of methane;3-(3-oxopropyl)benzamide?
The InChIKey is PXHLHJFUQDVOAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2.CH4/c11-10(13)9-5-1-3-8(7-9)4-2-6-12;/h1,3,5-7H,2,4H2,(H2,11,13);1H4.
What are the key properties of methane;3-(3-oxopropyl)benzamide?
methane;3-(3-oxopropyl)benzamide has a molecular weight of 193.25 g/mol, XLogP of 1.55, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-(3-oxopropyl)benzamide is sourced from PubChem (CID 178062718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).