About [3-(5-oxopentyl)phenyl] propanoate
[3-(5-oxopentyl)phenyl] propanoate (PubChem CID 54228537) has the molecular formula C14H18O3
and a molecular weight of 234.30 g/mol. Its IUPAC name is [3-(5-oxopentyl)phenyl] propanoate.
Molecular Properties
| Compound Name | [3-(5-oxopentyl)phenyl] propanoate |
| PubChem CID | 54228537 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | [3-(5-oxopentyl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(CCCCC=O)c1 |
| InChI | InChI=1S/C14H18O3/c1-2-14(16)17-13-9-6-8-12(11-13)7-4-3-5-10-15/h6,8-11H,2-5,7H2,1H3 |
| InChIKey | FXARYPFYZDCVFY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(5-oxopentyl)phenyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5-oxopentyl)phenyl] propanoate?
The IUPAC name of [3-(5-oxopentyl)phenyl] propanoate (CID 54228537) is [3-(5-oxopentyl)phenyl] propanoate.
What is the SMILES notation for [3-(5-oxopentyl)phenyl] propanoate?
The canonical SMILES for [3-(5-oxopentyl)phenyl] propanoate is CCC(=O)Oc1cccc(CCCCC=O)c1.
What is the InChIKey of [3-(5-oxopentyl)phenyl] propanoate?
The InChIKey is FXARYPFYZDCVFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c1-2-14(16)17-13-9-6-8-12(11-13)7-4-3-5-10-15/h6,8-11H,2-5,7H2,1H3.
What are the key properties of [3-(5-oxopentyl)phenyl] propanoate?
[3-(5-oxopentyl)phenyl] propanoate has a molecular weight of 234.30 g/mol, XLogP of 2.91, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5-oxopentyl)phenyl] propanoate is sourced from PubChem (CID 54228537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).