C24H36O2S6 — CID 148877462
[3-[7-(6-propyl-3,4,5,8,9,10-hexathiabicyclo[5.3.1]undecan-2-yl)heptyl]phenyl] propanoate (PubChem CID 148877462) has the molecular formula C24H36O2S6 and a molecular weight of 548.95 g/mol. Its IUPAC name is [3-[7-(6-propyl-3,4,5,8,9,10-hexathiabicyclo[5.3.1]undecan-2-yl)heptyl]phenyl] propanoate.
| Compound Name | [3-[7-(6-propyl-3,4,5,8,9,10-hexathiabicyclo[5.3.1]undecan-2-yl)heptyl]phenyl] propanoate |
|---|---|
| PubChem CID | 148877462 |
| Molecular Formula | C24H36O2S6 |
| Molecular Weight | 548.95 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | [3-[7-(6-propyl-3,4,5,8,9,10-hexathiabicyclo[5.3.1]undecan-2-yl)heptyl]phenyl] propanoate |
| SMILES | CCCC1SSSC(CCCCCCCc2cccc(OC(=O)CC)c2)C2CC1SSS2 |
| InChI | InChI=1S/C24H36O2S6/c1-3-11-20-22-17-23(30-32-29-22)21(28-31-27-20)15-9-7-5-6-8-12-18-13-10-14-19(16-18)26-24(25)4-2/h10,13-14,16,20-23H,3-9,11-12,15,17H2,1-2H3 |
| InChIKey | PCJUGKBTTJYJDV-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.95 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|