C50H80O2S4 — CID 162770700
2-tert-butyl-5-[7-[3-[[6-[[3-[7-(4-tert-butyl-3-hydroxyphenyl)heptyl]thiiran-2-yl]methyl]-3,5-dipropyl-1,4-dithian-2-yl]methyl]thiiran-2-yl]heptyl]phenol (PubChem CID 162770700) has the molecular formula C50H80O2S4 and a molecular weight of 841.46 g/mol. Its IUPAC name is 2-tert-butyl-5-[7-[3-[[6-[[3-[7-(4-tert-butyl-3-hydroxyphenyl)heptyl]thiiran-2-yl]methyl]-3,5-dipropyl-1,4-dithian-2-yl]methyl]thiiran-2-yl]heptyl]phenol.
| Compound Name | 2-tert-butyl-5-[7-[3-[[6-[[3-[7-(4-tert-butyl-3-hydroxyphenyl)heptyl]thiiran-2-yl]methyl]-3,5-dipropyl-1,4-dithian-2-yl]methyl]thiiran-2-yl]heptyl]phenol |
|---|---|
| PubChem CID | 162770700 |
| Molecular Formula | C50H80O2S4 |
| Molecular Weight | 841.46 g/mol |
| Exact Mass | 840.50 |
| IUPAC Name | 2-tert-butyl-5-[7-[3-[[6-[[3-[7-(4-tert-butyl-3-hydroxyphenyl)heptyl]thiiran-2-yl]methyl]-3,5-dipropyl-1,4-dithian-2-yl]methyl]thiiran-2-yl]heptyl]phenol |
| SMILES | CCCC1SC(CCC)C(CC2SC2CCCCCCCc2ccc(C(C)(C)C)c(O)c2)SC1CC1SC1CCCCCCCc1ccc(C(C)(C)C)c(O)c1 |
| InChI | InChI=1S/C50H80O2S4/c1-9-21-41-45(33-47-43(54-47)25-19-15-11-13-17-23-35-27-29-37(39(51)31-35)49(3,4)5)56-46(42(53-41)22-10-2)34-48-44(55-48)26-20-16-12-14-18-24-36-28-30-38(40(52)32-36)50(6,7)8/h27-32,41-48,51-52H,9-26,33-34H2,1-8H3 |
| InChIKey | WEXXWNJWRGGZKM-UHFFFAOYSA-N |
| XLogP | 15.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.46 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|