C52H84O2S4 — CID 170271511
2-tert-butyl-5-[7-[7-[7-(4-tert-butyl-3-hydroxyphenyl)heptyl]-6-(2-methylhexyl)-4-[[2-(thiiran-2-ylmethyl)cyclopropyl]methyl]-1,2,5-trithiepan-3-yl]heptyl]phenol (PubChem CID 170271511) has the molecular formula C52H84O2S4 and a molecular weight of 869.51 g/mol. Its IUPAC name is 2-tert-butyl-5-[7-[7-[7-(4-tert-butyl-3-hydroxyphenyl)heptyl]-6-(2-methylhexyl)-4-[[2-(thiiran-2-ylmethyl)cyclopropyl]methyl]-1,2,5-trithiepan-3-yl]heptyl]phenol.
| Compound Name | 2-tert-butyl-5-[7-[7-[7-(4-tert-butyl-3-hydroxyphenyl)heptyl]-6-(2-methylhexyl)-4-[[2-(thiiran-2-ylmethyl)cyclopropyl]methyl]-1,2,5-trithiepan-3-yl]heptyl]phenol |
|---|---|
| PubChem CID | 170271511 |
| Molecular Formula | C52H84O2S4 |
| Molecular Weight | 869.51 g/mol |
| Exact Mass | 868.54 |
| IUPAC Name | 2-tert-butyl-5-[7-[7-[7-(4-tert-butyl-3-hydroxyphenyl)heptyl]-6-(2-methylhexyl)-4-[[2-(thiiran-2-ylmethyl)cyclopropyl]methyl]-1,2,5-trithiepan-3-yl]heptyl]phenol |
| SMILES | CCCCC(C)CC1SC(CC2CC2CC2CS2)C(CCCCCCCc2ccc(C(C)(C)C)c(O)c2)SSC1CCCCCCCc1ccc(C(C)(C)C)c(O)c1 |
| InChI | InChI=1S/C52H84O2S4/c1-9-10-21-37(2)30-49-47(24-19-15-11-13-17-22-38-26-28-43(45(53)31-38)51(3,4)5)57-58-48(50(56-49)35-41-33-40(41)34-42-36-55-42)25-20-16-12-14-18-23-39-27-29-44(46(54)32-39)52(6,7)8/h26-29,31-32,37,40-42,47-50,53-54H,9-25,30,33-36H2,1-8H3 |
| InChIKey | CQOJAGKONSQSBH-UHFFFAOYSA-N |
| XLogP | 16.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.51 |
| LogP ≤ 5 | 16.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|