C53H86O4S3 — CID 170270984
[3-[7-[4,6-dihexyl-7-[7-(3-propanoyloxyphenyl)heptyl]-1,2,5-trithiepan-3-yl]heptyl]phenyl] octanoate (PubChem CID 170270984) has the molecular formula C53H86O4S3 and a molecular weight of 883.47 g/mol. Its IUPAC name is [3-[7-[4,6-dihexyl-7-[7-(3-propanoyloxyphenyl)heptyl]-1,2,5-trithiepan-3-yl]heptyl]phenyl] octanoate.
| Compound Name | [3-[7-[4,6-dihexyl-7-[7-(3-propanoyloxyphenyl)heptyl]-1,2,5-trithiepan-3-yl]heptyl]phenyl] octanoate |
|---|---|
| PubChem CID | 170270984 |
| Molecular Formula | C53H86O4S3 |
| Molecular Weight | 883.47 g/mol |
| Exact Mass | 882.57 |
| IUPAC Name | [3-[7-[4,6-dihexyl-7-[7-(3-propanoyloxyphenyl)heptyl]-1,2,5-trithiepan-3-yl]heptyl]phenyl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1cccc(CCCCCCCC2SSC(CCCCCCCc3cccc(OC(=O)CC)c3)C(CCCCCC)SC2CCCCCC)c1 |
| InChI | InChI=1S/C53H86O4S3/c1-5-9-12-17-28-41-53(55)57-47-36-30-34-45(43-47)32-23-19-16-21-27-40-51-49(38-25-14-11-7-3)58-48(37-24-13-10-6-2)50(59-60-51)39-26-20-15-18-22-31-44-33-29-35-46(42-44)56-52(54)8-4/h29-30,33-36,42-43,48-51H,5-28,31-32,37-41H2,1-4H3 |
| InChIKey | HNSGMFSWCGOZAO-UHFFFAOYSA-N |
| XLogP | 17.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.47 |
| LogP ≤ 5 | 17.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|