C26H38O2 — CID 138634849
2,4-ditert-butyl-5-[2-(4-tert-butyl-3-hydroxyphenyl)ethyl]phenol (PubChem CID 138634849) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is 2,4-ditert-butyl-5-[2-(4-tert-butyl-3-hydroxyphenyl)ethyl]phenol.
| Compound Name | 2,4-ditert-butyl-5-[2-(4-tert-butyl-3-hydroxyphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 138634849 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | 2,4-ditert-butyl-5-[2-(4-tert-butyl-3-hydroxyphenyl)ethyl]phenol |
| SMILES | CC(C)(C)c1ccc(CCc2cc(O)c(C(C)(C)C)cc2C(C)(C)C)cc1O |
| InChI | InChI=1S/C26H38O2/c1-24(2,3)19-13-11-17(14-22(19)27)10-12-18-15-23(28)21(26(7,8)9)16-20(18)25(4,5)6/h11,13-16,27-28H,10,12H2,1-9H3 |
| InChIKey | FNNCOQZKWVXLMQ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |