C46H70O3 — CID 139643650
4-[3,3-bis(2,5-ditert-butyl-4-hydroxyphenyl)butyl]-2,5-ditert-butylphenol (PubChem CID 139643650) has the molecular formula C46H70O3 and a molecular weight of 671.06 g/mol. Its IUPAC name is 4-[3,3-bis(2,5-ditert-butyl-4-hydroxyphenyl)butyl]-2,5-ditert-butylphenol.
| Compound Name | 4-[3,3-bis(2,5-ditert-butyl-4-hydroxyphenyl)butyl]-2,5-ditert-butylphenol |
|---|---|
| PubChem CID | 139643650 |
| Molecular Formula | C46H70O3 |
| Molecular Weight | 671.06 g/mol |
| Exact Mass | 670.53 |
| IUPAC Name | 4-[3,3-bis(2,5-ditert-butyl-4-hydroxyphenyl)butyl]-2,5-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(CCC(C)(c2cc(C(C)(C)C)c(O)cc2C(C)(C)C)c2cc(C(C)(C)C)c(O)cc2C(C)(C)C)c(C(C)(C)C)cc1O |
| InChI | InChI=1S/C46H70O3/c1-40(2,3)29-25-37(47)34(43(10,11)12)22-28(29)20-21-46(19,32-23-35(44(13,14)15)38(48)26-30(32)41(4,5)6)33-24-36(45(16,17)18)39(49)27-31(33)42(7,8)9/h22-27,47-49H,20-21H2,1-19H3 |
| InChIKey | IGWTXEOWLTULNW-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.06 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |