C48H66O4 — CID 160646007
2-tert-butyl-5-methyl-4-[2,3,3-tris(5-tert-butyl-4-hydroxy-2-methylphenyl)butan-2-yl]phenol (PubChem CID 160646007) has the molecular formula C48H66O4 and a molecular weight of 707.05 g/mol. Its IUPAC name is 2-tert-butyl-5-methyl-4-[2,3,3-tris(5-tert-butyl-4-hydroxy-2-methylphenyl)butan-2-yl]phenol.
| Compound Name | 2-tert-butyl-5-methyl-4-[2,3,3-tris(5-tert-butyl-4-hydroxy-2-methylphenyl)butan-2-yl]phenol |
|---|---|
| PubChem CID | 160646007 |
| Molecular Formula | C48H66O4 |
| Molecular Weight | 707.05 g/mol |
| Exact Mass | 706.50 |
| IUPAC Name | 2-tert-butyl-5-methyl-4-[2,3,3-tris(5-tert-butyl-4-hydroxy-2-methylphenyl)butan-2-yl]phenol |
| SMILES | Cc1cc(O)c(C(C)(C)C)cc1C(C)(c1cc(C(C)(C)C)c(O)cc1C)C(C)(c1cc(C(C)(C)C)c(O)cc1C)c1cc(C(C)(C)C)c(O)cc1C |
| InChI | InChI=1S/C48H66O4/c1-27-19-39(49)35(43(5,6)7)23-31(27)47(17,32-24-36(44(8,9)10)40(50)20-28(32)2)48(18,33-25-37(45(11,12)13)41(51)21-29(33)3)34-26-38(46(14,15)16)42(52)22-30(34)4/h19-26,49-52H,1-18H3 |
| InChIKey | RJUHETYEOATZMU-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.05 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |