C15H24OTi — CID 174406764
2,4-ditert-butyl-5-methylphenol;titanium (PubChem CID 174406764) has the molecular formula C15H24OTi and a molecular weight of 268.22 g/mol. Its IUPAC name is 2,4-ditert-butyl-5-methylphenol;titanium.
| Compound Name | 2,4-ditert-butyl-5-methylphenol;titanium |
|---|---|
| PubChem CID | 174406764 |
| Molecular Formula | C15H24OTi |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2,4-ditert-butyl-5-methylphenol;titanium |
| SMILES | Cc1cc(O)c(C(C)(C)C)cc1C(C)(C)C.[Ti] |
| InChI | InChI=1S/C15H24O.Ti/c1-10-8-13(16)12(15(5,6)7)9-11(10)14(2,3)4;/h8-9,16H,1-7H3; |
| InChIKey | NUQBOSADCDDJLY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |