C40H58O3 — CID 57198383
2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)-1-(3,5-ditert-butyl-4-hydroxyphenyl)butyl]-5-methylphenol (PubChem CID 57198383) has the molecular formula C40H58O3 and a molecular weight of 586.90 g/mol. Its IUPAC name is 2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)-1-(3,5-ditert-butyl-4-hydroxyphenyl)butyl]-5-methylphenol.
| Compound Name | 2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)-1-(3,5-ditert-butyl-4-hydroxyphenyl)butyl]-5-methylphenol |
|---|---|
| PubChem CID | 57198383 |
| Molecular Formula | C40H58O3 |
| Molecular Weight | 586.90 g/mol |
| Exact Mass | 586.44 |
| IUPAC Name | 2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)-1-(3,5-ditert-butyl-4-hydroxyphenyl)butyl]-5-methylphenol |
| SMILES | CCCC(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)(c1cc(C(C)(C)C)c(O)cc1C)c1cc(C(C)(C)C)c(O)cc1C |
| InChI | InChI=1S/C40H58O3/c1-16-17-40(27-22-29(36(4,5)6)33(41)18-24(27)2,28-23-30(37(7,8)9)34(42)19-25(28)3)26-20-31(38(10,11)12)35(43)32(21-26)39(13,14)15/h18-23,41-43H,16-17H2,1-15H3 |
| InChIKey | KGWOOILXOSVPGZ-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.90 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|