C61H92O4 — CID 141133723
2,6-ditert-butyl-4-[2,4,4-tris(3,5-ditert-butyl-4-hydroxyphenyl)pentan-2-yl]phenol (PubChem CID 141133723) has the molecular formula C61H92O4 and a molecular weight of 889.40 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2,4,4-tris(3,5-ditert-butyl-4-hydroxyphenyl)pentan-2-yl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[2,4,4-tris(3,5-ditert-butyl-4-hydroxyphenyl)pentan-2-yl]phenol |
|---|---|
| PubChem CID | 141133723 |
| Molecular Formula | C61H92O4 |
| Molecular Weight | 889.40 g/mol |
| Exact Mass | 888.70 |
| IUPAC Name | 2,6-ditert-butyl-4-[2,4,4-tris(3,5-ditert-butyl-4-hydroxyphenyl)pentan-2-yl]phenol |
| SMILES | CC(C)(C)c1cc(C(C)(CC(C)(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C61H92O4/c1-52(2,3)40-27-36(28-41(48(40)62)53(4,5)6)60(25,37-29-42(54(7,8)9)49(63)43(30-37)55(10,11)12)35-61(26,38-31-44(56(13,14)15)50(64)45(32-38)57(16,17)18)39-33-46(58(19,20)21)51(65)47(34-39)59(22,23)24/h27-34,62-65H,35H2,1-26H3 |
| InChIKey | IIUMRCHSHJIUOF-UHFFFAOYSA-N |
| XLogP | 16.59 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.40 |
| LogP ≤ 5 | 16.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |