C30H50O6 — CID 172795780
bis(2,6-ditert-butylbenzene-1,4-diol);ethane-1,2-diol (PubChem CID 172795780) has the molecular formula C30H50O6 and a molecular weight of 506.72 g/mol. Its IUPAC name is bis(2,6-ditert-butylbenzene-1,4-diol);ethane-1,2-diol.
| Compound Name | bis(2,6-ditert-butylbenzene-1,4-diol);ethane-1,2-diol |
|---|---|
| PubChem CID | 172795780 |
| Molecular Formula | C30H50O6 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | bis(2,6-ditert-butylbenzene-1,4-diol);ethane-1,2-diol |
| SMILES | CC(C)(C)c1cc(O)cc(C(C)(C)C)c1O.CC(C)(C)c1cc(O)cc(C(C)(C)C)c1O.OCCO |
| InChI | InChI=1S/2C14H22O2.C2H6O2/c2*1-13(2,3)10-7-9(15)8-11(12(10)16)14(4,5)6;3-1-2-4/h2*7-8,15-16H,1-6H3;3-4H,1-2H2 |
| InChIKey | QEJXKDFATSHXKA-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|