C17H30O3 — CID 175362699
2,6-ditert-butyl-4-methylphenol;ethane-1,2-diol (PubChem CID 175362699) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-methylphenol;ethane-1,2-diol.
| Compound Name | 2,6-ditert-butyl-4-methylphenol;ethane-1,2-diol |
|---|---|
| PubChem CID | 175362699 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 2,6-ditert-butyl-4-methylphenol;ethane-1,2-diol |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.OCCO |
| InChI | InChI=1S/C15H24O.C2H6O2/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7;3-1-2-4/h8-9,16H,1-7H3;3-4H,1-2H2 |
| InChIKey | JWYPMZHBPVQKLI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |