C25H38O2 — CID 19042670
2-tert-butylphenol;2,6-ditert-butyl-4-methylphenol (PubChem CID 19042670) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is 2-tert-butylphenol;2,6-ditert-butyl-4-methylphenol.
| Compound Name | 2-tert-butylphenol;2,6-ditert-butyl-4-methylphenol |
|---|---|
| PubChem CID | 19042670 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | 2-tert-butylphenol;2,6-ditert-butyl-4-methylphenol |
| SMILES | CC(C)(C)c1ccccc1O.Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H24O.C10H14O/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7;1-10(2,3)8-6-4-5-7-9(8)11/h8-9,16H,1-7H3;4-7,11H,1-3H3 |
| InChIKey | JXDDKQYRXQQVIP-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |