C22H32O2 — CID 141330574
2,6-ditert-butyl-4-methylphenol;3-methylphenol (PubChem CID 141330574) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-methylphenol;3-methylphenol.
| Compound Name | 2,6-ditert-butyl-4-methylphenol;3-methylphenol |
|---|---|
| PubChem CID | 141330574 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 2,6-ditert-butyl-4-methylphenol;3-methylphenol |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.Cc1cccc(O)c1 |
| InChI | InChI=1S/C15H24O.C7H8O/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7;1-6-3-2-4-7(8)5-6/h8-9,16H,1-7H3;2-5,8H,1H3 |
| InChIKey | ARAIVIUFUGPOOP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |