C16H28O2 — CID 161478470
2,6-ditert-butyl-4-methylphenol;methanol (PubChem CID 161478470) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-methylphenol;methanol.
| Compound Name | 2,6-ditert-butyl-4-methylphenol;methanol |
|---|---|
| PubChem CID | 161478470 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2,6-ditert-butyl-4-methylphenol;methanol |
| SMILES | CO.Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H24O.CH4O/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7;1-2/h8-9,16H,1-7H3;2H,1H3 |
| InChIKey | WEANCXGTERKLHG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |