C17H30N2O3S2 — CID 88528140
bis(carbamothioic S-acid);2,6-ditert-butyl-4-methylphenol (PubChem CID 88528140) has the molecular formula C17H30N2O3S2 and a molecular weight of 374.57 g/mol. Its IUPAC name is bis(carbamothioic S-acid);2,6-ditert-butyl-4-methylphenol.
| Compound Name | bis(carbamothioic S-acid);2,6-ditert-butyl-4-methylphenol |
|---|---|
| PubChem CID | 88528140 |
| Molecular Formula | C17H30N2O3S2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | bis(carbamothioic S-acid);2,6-ditert-butyl-4-methylphenol |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.NC(=O)S.NC(=O)S |
| InChI | InChI=1S/C15H24O.2CH3NOS/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7;2*2-1(3)4/h8-9,16H,1-7H3;2*(H3,2,3,4) |
| InChIKey | COUSGCQSBKWISH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|