C15H25ClOZr — CID 87931050
2,6-ditert-butyl-4-methylphenol;zirconium;hydrochloride (PubChem CID 87931050) has the molecular formula C15H25ClOZr and a molecular weight of 348.04 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-methylphenol;zirconium;hydrochloride.
| Compound Name | 2,6-ditert-butyl-4-methylphenol;zirconium;hydrochloride |
|---|---|
| PubChem CID | 87931050 |
| Molecular Formula | C15H25ClOZr |
| Molecular Weight | 348.04 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2,6-ditert-butyl-4-methylphenol;zirconium;hydrochloride |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.Cl.[Zr] |
| InChI | InChI=1S/C15H24O.ClH.Zr/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7;;/h8-9,16H,1-7H3;1H; |
| InChIKey | LHGBWYLFLIHAOS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.04 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |