C24H36O2 — CID 87814182
2-tert-butyl-4,6-dimethylphenol (PubChem CID 87814182) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is 2-tert-butyl-4,6-dimethylphenol.
| Compound Name | 2-tert-butyl-4,6-dimethylphenol |
|---|---|
| PubChem CID | 87814182 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 2-tert-butyl-4,6-dimethylphenol |
| SMILES | Cc1cc(C)c(O)c(C(C)(C)C)c1.Cc1cc(C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/2C12H18O/c2*1-8-6-9(2)11(13)10(7-8)12(3,4)5/h2*6-7,13H,1-5H3 |
| InChIKey | AMWPFXICICLPLF-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |