C15H26O3P+ — CID 135147079
2,6-ditert-butyl-4-methylphenol;hydroxy(oxo)phosphanium (PubChem CID 135147079) has the molecular formula C15H26O3P+ and a molecular weight of 285.34 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-methylphenol;hydroxy(oxo)phosphanium.
| Compound Name | 2,6-ditert-butyl-4-methylphenol;hydroxy(oxo)phosphanium |
|---|---|
| PubChem CID | 135147079 |
| Molecular Formula | C15H26O3P+ |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2,6-ditert-butyl-4-methylphenol;hydroxy(oxo)phosphanium |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.O=[PH+]O |
| InChI | InChI=1S/C15H24O.HO2P/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7;1-3-2/h8-9,16H,1-7H3;3H/p+1 |
| InChIKey | NNUTWMWRNNPMBQ-UHFFFAOYSA-O |
| XLogP | 4.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|