About 2,6-ditert-butyl-4-methylphenol;furan-2,5-dione
2,6-ditert-butyl-4-methylphenol;furan-2,5-dione (PubChem CID 158428660) has the molecular formula C19H26O4
and a molecular weight of 318.41 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-methylphenol;furan-2,5-dione.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-4-methylphenol;furan-2,5-dione |
| PubChem CID | 158428660 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2,6-ditert-butyl-4-methylphenol;furan-2,5-dione |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C15H24O.C4H2O3/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7;5-3-1-2-4(6)7-3/h8-9,16H,1-7H3;1-2H |
| InChIKey | HBJLPFLHWXZXCD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,6-ditert-butyl-4-methylphenol;furan-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-4-methylphenol;furan-2,5-dione?
The IUPAC name of 2,6-ditert-butyl-4-methylphenol;furan-2,5-dione (CID 158428660) is 2,6-ditert-butyl-4-methylphenol;furan-2,5-dione.
What is the SMILES notation for 2,6-ditert-butyl-4-methylphenol;furan-2,5-dione?
The canonical SMILES for 2,6-ditert-butyl-4-methylphenol;furan-2,5-dione is Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.O=C1C=CC(=O)O1.
What is the InChIKey of 2,6-ditert-butyl-4-methylphenol;furan-2,5-dione?
The InChIKey is HBJLPFLHWXZXCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O.C4H2O3/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7;5-3-1-2-4(6)7-3/h8-9,16H,1-7H3;1-2H.
What are the key properties of 2,6-ditert-butyl-4-methylphenol;furan-2,5-dione?
2,6-ditert-butyl-4-methylphenol;furan-2,5-dione has a molecular weight of 318.41 g/mol, XLogP of 3.92, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-4-methylphenol;furan-2,5-dione is sourced from PubChem (CID 158428660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).