C19H26O4 — CID 158428660
2,6-ditert-butyl-4-methylphenol;furan-2,5-dione (PubChem CID 158428660) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-methylphenol;furan-2,5-dione.
| Compound Name | 2,6-ditert-butyl-4-methylphenol;furan-2,5-dione |
|---|---|
| PubChem CID | 158428660 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2,6-ditert-butyl-4-methylphenol;furan-2,5-dione |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C15H24O.C4H2O3/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7;5-3-1-2-4(6)7-3/h8-9,16H,1-7H3;1-2H |
| InChIKey | HBJLPFLHWXZXCD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|