C25H34O4 — CID 88656141
2,2-bis(3-tert-butyl-2-hydroxy-5-methylphenyl)propanoic acid (PubChem CID 88656141) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is 2,2-bis(3-tert-butyl-2-hydroxy-5-methylphenyl)propanoic acid.
| Compound Name | 2,2-bis(3-tert-butyl-2-hydroxy-5-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 88656141 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 2,2-bis(3-tert-butyl-2-hydroxy-5-methylphenyl)propanoic acid |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C(C)(C(=O)O)c2cc(C)cc(C(C)(C)C)c2O)c1 |
| InChI | InChI=1S/C25H34O4/c1-14-10-16(23(3,4)5)20(26)18(12-14)25(9,22(28)29)19-13-15(2)11-17(21(19)27)24(6,7)8/h10-13,26-27H,1-9H3,(H,28,29) |
| InChIKey | ZWTBNWRKEQRWAN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |