About carbanide;3-methylphenol;yttrium
carbanide;3-methylphenol;yttrium (PubChem CID 161376652) has the molecular formula C8H11OY-
and a molecular weight of 212.08 g/mol. Its IUPAC name is carbanide;3-methylphenol;yttrium.
Molecular Properties
| Compound Name | carbanide;3-methylphenol;yttrium |
| PubChem CID | 161376652 |
| Molecular Formula | C8H11OY- |
| Molecular Weight | 212.08 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | carbanide;3-methylphenol;yttrium |
| SMILES | Cc1cccc(O)c1.[CH3-].[Y] |
| InChI | InChI=1S/C7H8O.CH3.Y/c1-6-3-2-4-7(8)5-6;;/h2-5,8H,1H3;1H3;/q;-1; |
| InChIKey | XKFKSWOUVZRFPW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.08 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;3-methylphenol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;3-methylphenol;yttrium?
The IUPAC name of carbanide;3-methylphenol;yttrium (CID 161376652) is carbanide;3-methylphenol;yttrium.
What is the SMILES notation for carbanide;3-methylphenol;yttrium?
The canonical SMILES for carbanide;3-methylphenol;yttrium is Cc1cccc(O)c1.[CH3-].[Y].
What is the InChIKey of carbanide;3-methylphenol;yttrium?
The InChIKey is XKFKSWOUVZRFPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.CH3.Y/c1-6-3-2-4-7(8)5-6;;/h2-5,8H,1H3;1H3;/q;-1;.
What are the key properties of carbanide;3-methylphenol;yttrium?
carbanide;3-methylphenol;yttrium has a molecular weight of 212.08 g/mol, XLogP of 2.15, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;3-methylphenol;yttrium is sourced from PubChem (CID 161376652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).