About 3-methylphenol;4-methylphenol;propane
3-methylphenol;4-methylphenol;propane (PubChem CID 157147188) has the molecular formula C20H32O2
and a molecular weight of 304.47 g/mol. Its IUPAC name is 3-methylphenol;4-methylphenol;propane.
Molecular Properties
| Compound Name | 3-methylphenol;4-methylphenol;propane |
| PubChem CID | 157147188 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 3-methylphenol;4-methylphenol;propane |
| SMILES | CCC.CCC.Cc1ccc(O)cc1.Cc1cccc(O)c1 |
| InChI | InChI=1S/2C7H8O.2C3H8/c1-6-2-4-7(8)5-3-6;1-6-3-2-4-7(8)5-6;2*1-3-2/h2*2-5,8H,1H3;2*3H2,1-2H3 |
| InChIKey | AKVMOBZTULDGMZ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylphenol;4-methylphenol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylphenol;4-methylphenol;propane?
The IUPAC name of 3-methylphenol;4-methylphenol;propane (CID 157147188) is 3-methylphenol;4-methylphenol;propane.
What is the SMILES notation for 3-methylphenol;4-methylphenol;propane?
The canonical SMILES for 3-methylphenol;4-methylphenol;propane is CCC.CCC.Cc1ccc(O)cc1.Cc1cccc(O)c1.
What is the InChIKey of 3-methylphenol;4-methylphenol;propane?
The InChIKey is AKVMOBZTULDGMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8O.2C3H8/c1-6-2-4-7(8)5-3-6;1-6-3-2-4-7(8)5-6;2*1-3-2/h2*2-5,8H,1H3;2*3H2,1-2H3.
What are the key properties of 3-methylphenol;4-methylphenol;propane?
3-methylphenol;4-methylphenol;propane has a molecular weight of 304.47 g/mol, XLogP of 6.23, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylphenol;4-methylphenol;propane is sourced from PubChem (CID 157147188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).