About formaldehyde;2-methylphenol;3-methylphenol;4-methylphenol
formaldehyde;2-methylphenol;3-methylphenol;4-methylphenol (PubChem CID 170853044) has the molecular formula C22H26O4
and a molecular weight of 354.45 g/mol. Its IUPAC name is formaldehyde;2-methylphenol;3-methylphenol;4-methylphenol.
Molecular Properties
| Compound Name | formaldehyde;2-methylphenol;3-methylphenol;4-methylphenol |
| PubChem CID | 170853044 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | formaldehyde;2-methylphenol;3-methylphenol;4-methylphenol |
| SMILES | C=O.Cc1ccc(O)cc1.Cc1cccc(O)c1.Cc1ccccc1O |
| InChI | InChI=1S/3C7H8O.CH2O/c1-6-2-4-7(8)5-3-6;1-6-3-2-4-7(8)5-6;1-6-4-2-3-5-7(6)8;1-2/h3*2-5,8H,1H3;1H2 |
| InChIKey | GFXJHVMGVJTANW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze formaldehyde;2-methylphenol;3-methylphenol;4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;2-methylphenol;3-methylphenol;4-methylphenol?
The IUPAC name of formaldehyde;2-methylphenol;3-methylphenol;4-methylphenol (CID 170853044) is formaldehyde;2-methylphenol;3-methylphenol;4-methylphenol.
What is the SMILES notation for formaldehyde;2-methylphenol;3-methylphenol;4-methylphenol?
The canonical SMILES for formaldehyde;2-methylphenol;3-methylphenol;4-methylphenol is C=O.Cc1ccc(O)cc1.Cc1cccc(O)c1.Cc1ccccc1O.
What is the InChIKey of formaldehyde;2-methylphenol;3-methylphenol;4-methylphenol?
The InChIKey is GFXJHVMGVJTANW-UHFFFAOYSA-N. The full InChI is InChI=1S/3C7H8O.CH2O/c1-6-2-4-7(8)5-3-6;1-6-3-2-4-7(8)5-6;1-6-4-2-3-5-7(6)8;1-2/h3*2-5,8H,1H3;1H2.
What are the key properties of formaldehyde;2-methylphenol;3-methylphenol;4-methylphenol?
formaldehyde;2-methylphenol;3-methylphenol;4-methylphenol has a molecular weight of 354.45 g/mol, XLogP of 4.92, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;2-methylphenol;3-methylphenol;4-methylphenol is sourced from PubChem (CID 170853044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).