About bis(4-methylaniline);3-methylphenol
bis(4-methylaniline);3-methylphenol (PubChem CID 144604707) has the molecular formula C21H26N2O
and a molecular weight of 322.45 g/mol. Its IUPAC name is bis(4-methylaniline);3-methylphenol.
Molecular Properties
| Compound Name | bis(4-methylaniline);3-methylphenol |
| PubChem CID | 144604707 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | bis(4-methylaniline);3-methylphenol |
| SMILES | Cc1ccc(N)cc1.Cc1ccc(N)cc1.Cc1cccc(O)c1 |
| InChI | InChI=1S/2C7H9N.C7H8O/c2*1-6-2-4-7(8)5-3-6;1-6-3-2-4-7(8)5-6/h2*2-5H,8H2,1H3;2-5,8H,1H3 |
| InChIKey | OFMZCOVGGDPTLO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze bis(4-methylaniline);3-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-methylaniline);3-methylphenol?
The IUPAC name of bis(4-methylaniline);3-methylphenol (CID 144604707) is bis(4-methylaniline);3-methylphenol.
What is the SMILES notation for bis(4-methylaniline);3-methylphenol?
The canonical SMILES for bis(4-methylaniline);3-methylphenol is Cc1ccc(N)cc1.Cc1ccc(N)cc1.Cc1cccc(O)c1.
What is the InChIKey of bis(4-methylaniline);3-methylphenol?
The InChIKey is OFMZCOVGGDPTLO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H9N.C7H8O/c2*1-6-2-4-7(8)5-3-6;1-6-3-2-4-7(8)5-6/h2*2-5H,8H2,1H3;2-5,8H,1H3.
What are the key properties of bis(4-methylaniline);3-methylphenol?
bis(4-methylaniline);3-methylphenol has a molecular weight of 322.45 g/mol, XLogP of 4.86, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-methylaniline);3-methylphenol is sourced from PubChem (CID 144604707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).