About dichlorocopper;4-methylaniline;3-nitrophenol
dichlorocopper;4-methylaniline;3-nitrophenol (PubChem CID 70478847) has the molecular formula C13H14Cl2CuN2O3
and a molecular weight of 380.72 g/mol. Its IUPAC name is dichlorocopper;4-methylaniline;3-nitrophenol.
Molecular Properties
| Compound Name | dichlorocopper;4-methylaniline;3-nitrophenol |
| PubChem CID | 70478847 |
| Molecular Formula | C13H14Cl2CuN2O3 |
| Molecular Weight | 380.72 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | dichlorocopper;4-methylaniline;3-nitrophenol |
| SMILES | Cc1ccc(N)cc1.Cl[Cu]Cl.O=[N+]([O-])c1cccc(O)c1 |
| InChI | InChI=1S/C7H9N.C6H5NO3.2ClH.Cu/c1-6-2-4-7(8)5-3-6;8-6-3-1-2-5(4-6)7(9)10;;;/h2-5H,8H2,1H3;1-4,8H;2*1H;/q;;;;+2/p-2 |
| InChIKey | TULBJRSPIPCEQB-UHFFFAOYSA-L |
| XLogP | 4.25 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.72 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dichlorocopper;4-methylaniline;3-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorocopper;4-methylaniline;3-nitrophenol?
The IUPAC name of dichlorocopper;4-methylaniline;3-nitrophenol (CID 70478847) is dichlorocopper;4-methylaniline;3-nitrophenol.
What is the SMILES notation for dichlorocopper;4-methylaniline;3-nitrophenol?
The canonical SMILES for dichlorocopper;4-methylaniline;3-nitrophenol is Cc1ccc(N)cc1.Cl[Cu]Cl.O=[N+]([O-])c1cccc(O)c1.
What is the InChIKey of dichlorocopper;4-methylaniline;3-nitrophenol?
The InChIKey is TULBJRSPIPCEQB-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H9N.C6H5NO3.2ClH.Cu/c1-6-2-4-7(8)5-3-6;8-6-3-1-2-5(4-6)7(9)10;;;/h2-5H,8H2,1H3;1-4,8H;2*1H;/q;;;;+2/p-2.
What are the key properties of dichlorocopper;4-methylaniline;3-nitrophenol?
dichlorocopper;4-methylaniline;3-nitrophenol has a molecular weight of 380.72 g/mol, XLogP of 4.25, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocopper;4-methylaniline;3-nitrophenol is sourced from PubChem (CID 70478847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).