About 1,3-dinitrobenzene;3-methylaniline
1,3-dinitrobenzene;3-methylaniline (PubChem CID 158923372) has the molecular formula C13H13N3O4
and a molecular weight of 275.26 g/mol. Its IUPAC name is 1,3-dinitrobenzene;3-methylaniline.
Molecular Properties
| Compound Name | 1,3-dinitrobenzene;3-methylaniline |
| PubChem CID | 158923372 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 1,3-dinitrobenzene;3-methylaniline |
| SMILES | Cc1cccc(N)c1.O=[N+]([O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H9N.C6H4N2O4/c1-6-3-2-4-7(8)5-6;9-7(10)5-2-1-3-6(4-5)8(11)12/h2-5H,8H2,1H3;1-4H |
| InChIKey | JICVFVNVUHXRND-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dinitrobenzene;3-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dinitrobenzene;3-methylaniline?
The IUPAC name of 1,3-dinitrobenzene;3-methylaniline (CID 158923372) is 1,3-dinitrobenzene;3-methylaniline.
What is the SMILES notation for 1,3-dinitrobenzene;3-methylaniline?
The canonical SMILES for 1,3-dinitrobenzene;3-methylaniline is Cc1cccc(N)c1.O=[N+]([O-])c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 1,3-dinitrobenzene;3-methylaniline?
The InChIKey is JICVFVNVUHXRND-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C6H4N2O4/c1-6-3-2-4-7(8)5-6;9-7(10)5-2-1-3-6(4-5)8(11)12/h2-5H,8H2,1H3;1-4H.
What are the key properties of 1,3-dinitrobenzene;3-methylaniline?
1,3-dinitrobenzene;3-methylaniline has a molecular weight of 275.26 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dinitrobenzene;3-methylaniline is sourced from PubChem (CID 158923372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).