About nitric acid;1,3-xylene
nitric acid;1,3-xylene (PubChem CID 172865118) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is nitric acid;1,3-xylene.
Molecular Properties
| Compound Name | nitric acid;1,3-xylene |
| PubChem CID | 172865118 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | nitric acid;1,3-xylene |
| SMILES | Cc1cccc(C)c1.O=[N+]([O-])O |
| InChI | InChI=1S/C8H10.HNO3/c1-7-4-3-5-8(2)6-7;2-1(3)4/h3-6H,1-2H3;(H,2,3,4) |
| InChIKey | ZWPWXDGMDFVFPQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitric acid;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitric acid;1,3-xylene?
The IUPAC name of nitric acid;1,3-xylene (CID 172865118) is nitric acid;1,3-xylene.
What is the SMILES notation for nitric acid;1,3-xylene?
The canonical SMILES for nitric acid;1,3-xylene is Cc1cccc(C)c1.O=[N+]([O-])O.
What is the InChIKey of nitric acid;1,3-xylene?
The InChIKey is ZWPWXDGMDFVFPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.HNO3/c1-7-4-3-5-8(2)6-7;2-1(3)4/h3-6H,1-2H3;(H,2,3,4).
What are the key properties of nitric acid;1,3-xylene?
nitric acid;1,3-xylene has a molecular weight of 169.18 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nitric acid;1,3-xylene is sourced from PubChem (CID 172865118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).