About dioxoosmium;1,3-xylene
dioxoosmium;1,3-xylene (PubChem CID 57347095) has the molecular formula C8H10O2Os
and a molecular weight of 328.40 g/mol. Its IUPAC name is dioxoosmium;1,3-xylene.
Molecular Properties
| Compound Name | dioxoosmium;1,3-xylene |
| PubChem CID | 57347095 |
| Molecular Formula | C8H10O2Os |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | dioxoosmium;1,3-xylene |
| SMILES | Cc1cccc(C)c1.O=[Os]=O |
| InChI | InChI=1S/C8H10.2O.Os/c1-7-4-3-5-8(2)6-7;;;/h3-6H,1-2H3;;; |
| InChIKey | AEFWXEAPMAROBH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dioxoosmium;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxoosmium;1,3-xylene?
The IUPAC name of dioxoosmium;1,3-xylene (CID 57347095) is dioxoosmium;1,3-xylene.
What is the SMILES notation for dioxoosmium;1,3-xylene?
The canonical SMILES for dioxoosmium;1,3-xylene is Cc1cccc(C)c1.O=[Os]=O.
What is the InChIKey of dioxoosmium;1,3-xylene?
The InChIKey is AEFWXEAPMAROBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.2O.Os/c1-7-4-3-5-8(2)6-7;;;/h3-6H,1-2H3;;;.
What are the key properties of dioxoosmium;1,3-xylene?
dioxoosmium;1,3-xylene has a molecular weight of 328.40 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dioxoosmium;1,3-xylene is sourced from PubChem (CID 57347095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).