About 1-methyl-3-nitrobenzene chloride
1-methyl-3-nitrobenzene chloride (PubChem CID 20509973) has the molecular formula C7H7ClNO2-
and a molecular weight of 172.59 g/mol. Its IUPAC name is 1-methyl-3-nitrobenzene chloride.
Molecular Properties
| Compound Name | 1-methyl-3-nitrobenzene chloride |
| PubChem CID | 20509973 |
| Molecular Formula | C7H7ClNO2- |
| Molecular Weight | 172.59 g/mol |
| Exact Mass | 172.02 |
| IUPAC Name | 1-methyl-3-nitrobenzene chloride |
| SMILES | Cc1cccc([N+](=O)[O-])c1.[Cl-] |
| InChI | InChI=1S/C7H7NO2.ClH/c1-6-3-2-4-7(5-6)8(9)10;/h2-5H,1H3;1H/p-1 |
| InChIKey | SVWKMSJXFNBHOC-UHFFFAOYSA-M |
| XLogP | -1.09 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.59 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-nitrobenzene chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-nitrobenzene chloride?
The IUPAC name of 1-methyl-3-nitrobenzene chloride (CID 20509973) is 1-methyl-3-nitrobenzene chloride.
What is the SMILES notation for 1-methyl-3-nitrobenzene chloride?
The canonical SMILES for 1-methyl-3-nitrobenzene chloride is Cc1cccc([N+](=O)[O-])c1.[Cl-].
What is the InChIKey of 1-methyl-3-nitrobenzene chloride?
The InChIKey is SVWKMSJXFNBHOC-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7NO2.ClH/c1-6-3-2-4-7(5-6)8(9)10;/h2-5H,1H3;1H/p-1.
What are the key properties of 1-methyl-3-nitrobenzene chloride?
1-methyl-3-nitrobenzene chloride has a molecular weight of 172.59 g/mol, XLogP of -1.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-nitrobenzene chloride is sourced from PubChem (CID 20509973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).