About 1-methyl-3-nitrobenzene;3-(trifluoromethyl)benzamide
1-methyl-3-nitrobenzene;3-(trifluoromethyl)benzamide (PubChem CID 174838566) has the molecular formula C15H13F3N2O3
and a molecular weight of 326.27 g/mol. Its IUPAC name is 1-methyl-3-nitrobenzene;3-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | 1-methyl-3-nitrobenzene;3-(trifluoromethyl)benzamide |
| PubChem CID | 174838566 |
| Molecular Formula | C15H13F3N2O3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-methyl-3-nitrobenzene;3-(trifluoromethyl)benzamide |
| SMILES | Cc1cccc([N+](=O)[O-])c1.NC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H6F3NO.C7H7NO2/c9-8(10,11)6-3-1-2-5(4-6)7(12)13;1-6-3-2-4-7(5-6)8(9)10/h1-4H,(H2,12,13);2-5H,1H3 |
| InChIKey | HXRRLWOWBDRJSL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-nitrobenzene;3-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-nitrobenzene;3-(trifluoromethyl)benzamide?
The IUPAC name of 1-methyl-3-nitrobenzene;3-(trifluoromethyl)benzamide (CID 174838566) is 1-methyl-3-nitrobenzene;3-(trifluoromethyl)benzamide.
What is the SMILES notation for 1-methyl-3-nitrobenzene;3-(trifluoromethyl)benzamide?
The canonical SMILES for 1-methyl-3-nitrobenzene;3-(trifluoromethyl)benzamide is Cc1cccc([N+](=O)[O-])c1.NC(=O)c1cccc(C(F)(F)F)c1.
What is the InChIKey of 1-methyl-3-nitrobenzene;3-(trifluoromethyl)benzamide?
The InChIKey is HXRRLWOWBDRJSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3NO.C7H7NO2/c9-8(10,11)6-3-1-2-5(4-6)7(12)13;1-6-3-2-4-7(5-6)8(9)10/h1-4H,(H2,12,13);2-5H,1H3.
What are the key properties of 1-methyl-3-nitrobenzene;3-(trifluoromethyl)benzamide?
1-methyl-3-nitrobenzene;3-(trifluoromethyl)benzamide has a molecular weight of 326.27 g/mol, XLogP of 3.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-nitrobenzene;3-(trifluoromethyl)benzamide is sourced from PubChem (CID 174838566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).