C25H15F3N2O4 — CID 141365870
1,3-bis(3-nitrophenyl)-5-[3-(trifluoromethyl)phenyl]benzene (PubChem CID 141365870) has the molecular formula C25H15F3N2O4 and a molecular weight of 464.40 g/mol. Its IUPAC name is 1,3-bis(3-nitrophenyl)-5-[3-(trifluoromethyl)phenyl]benzene.
| Compound Name | 1,3-bis(3-nitrophenyl)-5-[3-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 141365870 |
| Molecular Formula | C25H15F3N2O4 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 1,3-bis(3-nitrophenyl)-5-[3-(trifluoromethyl)phenyl]benzene |
| SMILES | O=[N+]([O-])c1cccc(-c2cc(-c3cccc([N+](=O)[O-])c3)cc(-c3cccc(C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C25H15F3N2O4/c26-25(27,28)22-7-1-4-16(13-22)19-10-20(17-5-2-8-23(14-17)29(31)32)12-21(11-19)18-6-3-9-24(15-18)30(33)34/h1-15H |
| InChIKey | NCLFCKMRHWELND-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|