C8H4F5NO2 — CID 23233412
1-nitro-3-(1,1,2,2,2-pentafluoroethyl)benzene (PubChem CID 23233412) has the molecular formula C8H4F5NO2 and a molecular weight of 241.12 g/mol. Its IUPAC name is 1-nitro-3-(1,1,2,2,2-pentafluoroethyl)benzene.
| Compound Name | 1-nitro-3-(1,1,2,2,2-pentafluoroethyl)benzene |
|---|---|
| PubChem CID | 23233412 |
| Molecular Formula | C8H4F5NO2 |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 1-nitro-3-(1,1,2,2,2-pentafluoroethyl)benzene |
| SMILES | O=[N+]([O-])c1cccc(C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C8H4F5NO2/c9-7(10,8(11,12)13)5-2-1-3-6(4-5)14(15)16/h1-4H |
| InChIKey | PTNKXRHFXJJVLK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|