C10H4F9NO4 — CID 170557883
1-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]peroxy-3-nitrobenzene (PubChem CID 170557883) has the molecular formula C10H4F9NO4 and a molecular weight of 373.13 g/mol. Its IUPAC name is 1-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]peroxy-3-nitrobenzene.
| Compound Name | 1-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]peroxy-3-nitrobenzene |
|---|---|
| PubChem CID | 170557883 |
| Molecular Formula | C10H4F9NO4 |
| Molecular Weight | 373.13 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 1-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]peroxy-3-nitrobenzene |
| SMILES | O=[N+]([O-])c1cccc(OOC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H4F9NO4/c11-8(12,13)7(9(14,15)16,10(17,18)19)24-23-6-3-1-2-5(4-6)20(21)22/h1-4H |
| InChIKey | OVCLBNVVPPILKI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.13 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|