About 1-methoxy-3-nitrobenzene;sulfuryl dichloride
1-methoxy-3-nitrobenzene;sulfuryl dichloride (PubChem CID 87396674) has the molecular formula C7H7Cl2NO5S
and a molecular weight of 288.11 g/mol. Its IUPAC name is 1-methoxy-3-nitrobenzene;sulfuryl dichloride.
Molecular Properties
| Compound Name | 1-methoxy-3-nitrobenzene;sulfuryl dichloride |
| PubChem CID | 87396674 |
| Molecular Formula | C7H7Cl2NO5S |
| Molecular Weight | 288.11 g/mol |
| Exact Mass | 286.94 |
| IUPAC Name | 1-methoxy-3-nitrobenzene;sulfuryl dichloride |
| SMILES | COc1cccc([N+](=O)[O-])c1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C7H7NO3.Cl2O2S/c1-11-7-4-2-3-6(5-7)8(9)10;1-5(2,3)4/h2-5H,1H3; |
| InChIKey | JVFCHQFNQUTQOU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.11 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-3-nitrobenzene;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3-nitrobenzene;sulfuryl dichloride?
The IUPAC name of 1-methoxy-3-nitrobenzene;sulfuryl dichloride (CID 87396674) is 1-methoxy-3-nitrobenzene;sulfuryl dichloride.
What is the SMILES notation for 1-methoxy-3-nitrobenzene;sulfuryl dichloride?
The canonical SMILES for 1-methoxy-3-nitrobenzene;sulfuryl dichloride is COc1cccc([N+](=O)[O-])c1.O=S(=O)(Cl)Cl.
What is the InChIKey of 1-methoxy-3-nitrobenzene;sulfuryl dichloride?
The InChIKey is JVFCHQFNQUTQOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3.Cl2O2S/c1-11-7-4-2-3-6(5-7)8(9)10;1-5(2,3)4/h2-5H,1H3;.
What are the key properties of 1-methoxy-3-nitrobenzene;sulfuryl dichloride?
1-methoxy-3-nitrobenzene;sulfuryl dichloride has a molecular weight of 288.11 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3-nitrobenzene;sulfuryl dichloride is sourced from PubChem (CID 87396674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).