C14H14N2O6S — CID 2885763
N-(2,5-dimethoxyphenyl)-3-nitrobenzenesulfonamide (PubChem CID 2885763) has the molecular formula C14H14N2O6S and a molecular weight of 338.34 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-3-nitrobenzenesulfonamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 2885763 |
| Molecular Formula | C14H14N2O6S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc(OC)c(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C14H14N2O6S/c1-21-11-6-7-14(22-2)13(9-11)15-23(19,20)12-5-3-4-10(8-12)16(17)18/h3-9,15H,1-2H3 |
| InChIKey | LVJGQRBHDJBSDJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|