C25H24N2O10S — CID 2481912
[(2S)-1-(2,4-dimethoxyphenyl)-1-oxopropan-2-yl] 3-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzoate (PubChem CID 2481912) has the molecular formula C25H24N2O10S and a molecular weight of 544.54 g/mol. Its IUPAC name is [(2S)-1-(2,4-dimethoxyphenyl)-1-oxopropan-2-yl] 3-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzoate.
| Compound Name | [(2S)-1-(2,4-dimethoxyphenyl)-1-oxopropan-2-yl] 3-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2481912 |
| Molecular Formula | C25H24N2O10S |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | [(2S)-1-(2,4-dimethoxyphenyl)-1-oxopropan-2-yl] 3-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(C(=O)[C@H](C)OC(=O)c2cccc(S(=O)(=O)Nc3cc([N+](=O)[O-])ccc3OC)c2)c(OC)c1 |
| InChI | InChI=1S/C25H24N2O10S/c1-15(24(28)20-10-9-18(34-2)14-23(20)36-4)37-25(29)16-6-5-7-19(12-16)38(32,33)26-21-13-17(27(30)31)8-11-22(21)35-3/h5-15,26H,1-4H3/t15-/m0/s1 |
| InChIKey | ZFNRLXYPEYNKEK-HNNXBMFYSA-N |
| XLogP | 3.85 |
| TPSA | 160.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|