C15H16N2O7S — CID 8822749
N-(2,5-dimethoxyphenyl)-2-methoxy-5-nitrobenzenesulfonamide (PubChem CID 8822749) has the molecular formula C15H16N2O7S and a molecular weight of 368.37 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-methoxy-5-nitrobenzenesulfonamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-methoxy-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 8822749 |
| Molecular Formula | C15H16N2O7S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-methoxy-5-nitrobenzenesulfonamide |
| SMILES | COc1ccc(OC)c(NS(=O)(=O)c2cc([N+](=O)[O-])ccc2OC)c1 |
| InChI | InChI=1S/C15H16N2O7S/c1-22-11-5-7-13(23-2)12(9-11)16-25(20,21)15-8-10(17(18)19)4-6-14(15)24-3/h4-9,16H,1-3H3 |
| InChIKey | HXWXULVKMWYSJN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|