C22H23N3O7S — CID 31663976
2-[(2,5-dimethoxyphenyl)methylamino]-N-(2-methoxyphenyl)-5-nitrobenzenesulfonamide (PubChem CID 31663976) has the molecular formula C22H23N3O7S and a molecular weight of 473.51 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)methylamino]-N-(2-methoxyphenyl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-[(2,5-dimethoxyphenyl)methylamino]-N-(2-methoxyphenyl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 31663976 |
| Molecular Formula | C22H23N3O7S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)methylamino]-N-(2-methoxyphenyl)-5-nitrobenzenesulfonamide |
| SMILES | COc1ccc(OC)c(CNc2ccc([N+](=O)[O-])cc2S(=O)(=O)Nc2ccccc2OC)c1 |
| InChI | InChI=1S/C22H23N3O7S/c1-30-17-9-11-20(31-2)15(12-17)14-23-19-10-8-16(25(26)27)13-22(19)33(28,29)24-18-6-4-5-7-21(18)32-3/h4-13,23-24H,14H2,1-3H3 |
| InChIKey | YFBYOZNAWVSAEC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|