C20H16F3N3O9S3 — CID 68948180
2-methoxy-N-[2-[(3-nitrophenyl)sulfonylamino]phenyl]-5-(trifluoromethylsulfonyl)benzenesulfonamide (PubChem CID 68948180) has the molecular formula C20H16F3N3O9S3 and a molecular weight of 595.56 g/mol. Its IUPAC name is 2-methoxy-N-[2-[(3-nitrophenyl)sulfonylamino]phenyl]-5-(trifluoromethylsulfonyl)benzenesulfonamide.
| Compound Name | 2-methoxy-N-[2-[(3-nitrophenyl)sulfonylamino]phenyl]-5-(trifluoromethylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 68948180 |
| Molecular Formula | C20H16F3N3O9S3 |
| Molecular Weight | 595.56 g/mol |
| Exact Mass | 595.00 |
| IUPAC Name | 2-methoxy-N-[2-[(3-nitrophenyl)sulfonylamino]phenyl]-5-(trifluoromethylsulfonyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)C(F)(F)F)cc1S(=O)(=O)Nc1ccccc1NS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H16F3N3O9S3/c1-35-18-10-9-14(36(29,30)20(21,22)23)12-19(18)38(33,34)25-17-8-3-2-7-16(17)24-37(31,32)15-6-4-5-13(11-15)26(27)28/h2-12,24-25H,1H3 |
| InChIKey | DRTAFSSHXUATHX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 178.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|