C18H17NO4S — CID 823335
N-(2,5-dimethoxyphenyl)naphthalene-2-sulfonamide (PubChem CID 823335) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)naphthalene-2-sulfonamide.
| Compound Name | N-(2,5-dimethoxyphenyl)naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 823335 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)naphthalene-2-sulfonamide |
| SMILES | COc1ccc(OC)c(NS(=O)(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C18H17NO4S/c1-22-15-8-10-18(23-2)17(12-15)19-24(20,21)16-9-7-13-5-3-4-6-14(13)11-16/h3-12,19H,1-2H3 |
| InChIKey | CENXJRMWUXFKEH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |